Difference between revisions of "PWY-6643"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGDP DGDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGDP DGDP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6643 PWY-6643] ==
* smiles:
+
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
* inchi key:
+
** InChIKey=CIKGWCTVFSRMJU-KVQBGUIXSA-K
+
 
* common name:
 
* common name:
** dGDP
+
** coenzyme M biosynthesis II
* molecular weight:
+
* taxonomic range:
** 424.18   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2191 TAX-2191]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-94695 TAX-94695]
 
* Synonym(s):
 
* Synonym(s):
** 2'-deoxyguanosine-5'-diphosphate
+
** CoM biosynthesis II
** deoxyguanosine-diphosphate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14218]]
+
'''1''' reactions found over '''6''' reactions in the full pathway
* [[DGDPKIN-RXN]]
+
* [[RXN-11737]]
== Reaction(s) known to produce the compound ==
+
** 8 associated gene(s):
* [[RXN0-748]]
+
*** [[CHC_T00005085001_1]]
* [[RXN-14217]]
+
*** [[CHC_T00009477001]]
* [[GDPREDUCT-RXN]]
+
*** [[CHC_T00010017001]]
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00010197001]]
* [[RXN-14207]]
+
*** [[CHC_T00006498001_1]]
 +
*** [[CHC_T00008432001]]
 +
*** [[CHC_T00009477001_1]]
 +
*** [[CHC_T00003344001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R231-RXN R231-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R232-RXN R232-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R233-RXN R233-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R234-RXN R234-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11108 RXN-11108]
 
== External links  ==
 
== External links  ==
* CAS : 102783-74-4
+
{{#set: common name=coenzyme M biosynthesis II}}
* METABOLIGHTS : MTBLC58595
+
{{#set: taxonomic range=TAX-2191}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-94695}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245673 25245673]
+
{{#set: common name=CoM biosynthesis II}}
* HMDB : HMDB00960
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=6}}
** [http://www.genome.jp/dbget-bin/www_bget?C00361 C00361]
+
{{#set: completion rate=17.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58595 58595]
+
* BIGG : dgdp
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: inchi key=InChIKey=CIKGWCTVFSRMJU-KVQBGUIXSA-K}}
+
{{#set: common name=dGDP}}
+
{{#set: molecular weight=424.18    }}
+
{{#set: common name=2'-deoxyguanosine-5'-diphosphate|deoxyguanosine-diphosphate}}
+
{{#set: consumed by=RXN-14218|DGDPKIN-RXN}}
+
{{#set: produced by=RXN0-748|RXN-14217|GDPREDUCT-RXN}}
+
{{#set: consumed or produced by=RXN-14207}}
+

Latest revision as of 16:11, 9 January 2019

Pathway PWY-6643

  • common name:
    • coenzyme M biosynthesis II
  • taxonomic range:
  • Synonym(s):
    • CoM biosynthesis II

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links