Difference between revisions of "PWY-6863"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12129 CPD-12129] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12129 CPD-12129] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863] ==
−
* smiles:
+
−
** CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C
+
−
* inchi key:
+
−
** InChIKey=FWFJGQGPMZXTLM-WPPIEQSHSA-N
+
 
* common name:
 
* common name:
−
** menaquinol-12
+
** pyruvate fermentation to hexanol (engineered)
−
* molecular weight:
+
* taxonomic range:
−
** 991.617   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
−
** MKH2-12
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''10''' reactions found over '''11''' reactions in the full pathway
−
* [[RXN-9363]]
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[CHC_T00008981001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
*** [[CHC_T00008981001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
** 9 associated gene(s):
 +
*** [[CHC_T00008442001_1]]
 +
*** [[CHC_T00003376001_1]]
 +
*** [[CHC_T00001730001_1]]
 +
*** [[CHC_T00001454001_1]]
 +
*** [[CHC_T00003402001_1]]
 +
*** [[CHC_T00000866001_1]]
 +
*** [[CHC_T00009061001_1]]
 +
*** [[CHC_T00008758001_1]]
 +
*** [[CHC_T00000865001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-11662]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008882001_1]]
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00008557001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
* [[RXN-11667]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00008882001_1]]
 +
*** [[CHC_T00009110001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
* [[RXN-12558]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-12559]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-12565]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00008981001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
*** [[CHC_T00009422001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-12567]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00009349001_1]]
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00009190001_1]]
 +
*** [[CHC_T00009110001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-12568]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-12570]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008557001_1]]
 +
*** [[CHC_T00008882001_1]]
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HEXANOL-RXN HEXANOL-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=pyruvate fermentation to hexanol (engineered)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479280 45479280]
+
{{#set: taxonomic range=TAX-2759}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84550 84550]
+
{{#set: reaction found=10}}
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C}}
+
{{#set: total reaction=11}}
−
{{#set: inchi key=InChIKey=FWFJGQGPMZXTLM-WPPIEQSHSA-N}}
+
{{#set: completion rate=91.0}}
−
{{#set: common name=menaquinol-12}}
+
−
{{#set: molecular weight=991.617    }}
+
−
{{#set: common name=MKH2-12}}
+
−
{{#set: produced by=RXN-9363}}
+

Latest revision as of 15:33, 9 January 2019

Pathway PWY-6863

  • common name:
    • pyruvate fermentation to hexanol (engineered)
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

10 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-6863&oldid=20452"