Difference between revisions of "PWY-5895"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] == * smiles: ** C(OP(=O)([O-])...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5895 PWY-5895] ==
* smiles:
+
** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2))
+
* inchi key:
+
** InChIKey=PMFMJXPRNJUYMB-GWOFURMSSA-K
+
 
* common name:
 
* common name:
** N-(5-phosphoribosyl)-anthranilate
+
** menaquinol-13 biosynthesis
* molecular weight:
+
* taxonomic range:
** 346.21   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33882 TAX-33882]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-838 TAX-838]
 
* Synonym(s):
 
* Synonym(s):
** N-(5-phospho-D-ribosyl)-anthranilate
+
** vitamin K2 biosynthesis
** N-(5-phospho-β-D-ribosyl)-anthranilate
+
** menaquinone-13 biosynthesis
** 5-phosphoribosyl-anthranilate
+
** 5-P-ribosyl-anthranilate
+
** 5'-phosphoribosyl-anthranilate
+
** 5'-P-ribosyl-anthranilate
+
** N-(5-phosphoribosyl)-anthranilate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[PRAISOM-RXN]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-9366]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
* [[PRTRANS-RXN]]
+
*** [[CHC_T00000517001_1]]
 +
*** [[CHC_T00001339001_1]]
 +
*** [[CHC_T00000214001_1]]
 +
*** [[CHC_T00005416001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9365 RXN-9365]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=menaquinol-13 biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548600 9548600]
+
{{#set: taxonomic range=TAX-33882}}
* CHEBI:
+
{{#set: taxonomic range=TAX-838}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18277 18277]
+
{{#set: common name=vitamin K2 biosynthesis|menaquinone-13 biosynthesis}}
* BIGG : pran
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C04302 C04302]
+
{{#set: completion rate=50.0}}
{{#set: smiles=C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2))}}
+
{{#set: inchi key=InChIKey=PMFMJXPRNJUYMB-GWOFURMSSA-K}}
+
{{#set: common name=N-(5-phosphoribosyl)-anthranilate}}
+
{{#set: molecular weight=346.21    }}
+
{{#set: common name=N-(5-phospho-D-ribosyl)-anthranilate|N-(5-phospho-β-D-ribosyl)-anthranilate|5-phosphoribosyl-anthranilate|5-P-ribosyl-anthranilate|5'-phosphoribosyl-anthranilate|5'-P-ribosyl-anthranilate|N-(5-phosphoribosyl)-anthranilate}}
+
{{#set: consumed by=PRAISOM-RXN}}
+
{{#set: consumed or produced by=PRTRANS-RXN}}
+

Latest revision as of 16:43, 9 January 2019

Pathway PWY-5895

  • common name:
    • menaquinol-13 biosynthesis
  • taxonomic range:
  • Synonym(s):
    • vitamin K2 biosynthesis
    • menaquinone-13 biosynthesis

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links