Difference between revisions of "CPD-7105"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=BSUBPOLYAMSYN-PWY BSUBPOLYAMSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?obje...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=BSUBPOLYAMSYN-PWY BSUBPOLYAMSYN-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* molecular weight:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** 345.458   
 +
* inchi key:
 +
** InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M
 
* common name:
 
* common name:
** spermidine biosynthesis I
+
** diprenylphlorisovalerophenone
 
* Synonym(s):
 
* Synonym(s):
** arginine degradation to spermidine
+
** deoxyhumulone
** spermidine biosynthesis
+
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''2''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[SPERMIDINESYN-RXN]]
+
* [[RXN-7810]]
** [[SAMDECARB-RXN]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
* ECOCYC:
+
* PUBCHEM:
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=BSUBPOLYAMSYN-PWY BSUBPOLYAMSYN-PWY]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203000 25203000]
* ARACYC:
+
{{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C}}
** [http://metacyc.org/ARA/NEW-IMAGE?object=BSUBPOLYAMSYN-PWY BSUBPOLYAMSYN-PWY]
+
{{#set: molecular weight=345.458    }}
{{#set: taxonomic range=TAX-2759}}
+
{{#set: inchi key=InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M}}
{{#set: taxonomic range=TAX-2}}
+
{{#set: common name=diprenylphlorisovalerophenone}}
{{#set: taxonomic range=TAX-2157}}
+
{{#set: common name=deoxyhumulone}}
{{#set: common name=spermidine biosynthesis I}}
+
{{#set: produced by=RXN-7810}}
{{#set: common name=arginine degradation to spermidine|spermidine biosynthesis}}
+
{{#set: reaction found=2}}
+
{{#set: reaction not found=0}}
+

Latest revision as of 17:54, 9 January 2019

Metabolite CPD-7105

  • smiles:
    • CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C
  • molecular weight:
    • 345.458
  • inchi key:
    • InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M
  • common name:
    • diprenylphlorisovalerophenone
  • Synonym(s):
    • deoxyhumulone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C" cannot be used as a page name in this wiki.