Difference between revisions of "IDNCAT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * smiles: ** CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] * inchi key: ** InChIKe...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=IDNCAT-PWY IDNCAT-PWY] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-idonate degradation |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-idonic acid catabolism |
| − | ** | + | ** L-idonate catabolism |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[GLUCONOKIN-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| − | * [ | + | *** [[CHC_T00003912001_1]] |
| − | * [ | + | ** 1 reconstruction source(s) associated: |
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.264-RXN 1.1.1.264-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE-5-DEHYDROGENASE-RXN GLUCONATE-5-DEHYDROGENASE-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=IDNCAT-PWY IDNCAT-PWY] | |
| − | + | {{#set: common name=L-idonate degradation}} | |
| − | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
| − | + | {{#set: common name=L-idonic acid catabolism|L-idonate catabolism}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 16:50, 9 January 2019
Pathway IDNCAT-PWY
- common name:
- L-idonate degradation
- taxonomic range:
- Synonym(s):
- L-idonic acid catabolism
- L-idonate catabolism
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- GLUCONOKIN-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
