Difference between revisions of "CHC 615"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6333 PWY-6333] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6333 PWY-6333] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** acetaldehyde biosynthesis I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** anoxic acetaldehyde biosynthesis | ||
| + | ** flooding related acetaldehyde biosynthesis | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN | + | * '''1''' reaction(s) found |
| − | == Reaction(s) | + | ** [[ALCOHOL-DEHYDROG-RXN]] |
| − | * | + | == Reaction(s) not found == |
| − | + | * '''0''' reaction(s) not found | |
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=acetaldehyde biosynthesis I}} | |
| − | {{#set: | + | {{#set: common name=anoxic acetaldehyde biosynthesis|flooding related acetaldehyde biosynthesis}} |
| − | {{#set: | + | {{#set: reaction found=1}} |
| − | {{#set: common name= | + | {{#set: reaction not found=0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 10:58, 18 January 2018
Pathway PWY-6333
- taxonomic range:
- common name:
- acetaldehyde biosynthesis I
- Synonym(s):
- anoxic acetaldehyde biosynthesis
- flooding related acetaldehyde biosynthesis
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 0 reaction(s) not found
