Difference between revisions of "RXN-13304"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] == * smiles: ** C(NC1(NC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11478 RXN-11478] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11478 RXN-11478] ==
* smiles:
+
* direction:
** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)CO
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=XKQZIXVJVUPORE-RPDRRWSUSA-N
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
* common name:
+
** 5-amino-6-(D-ribitylamino)uracil
+
* molecular weight:
+
** 276.249   
+
 
* Synonym(s):
 
* Synonym(s):
** 6-(1-D-ribitylamino)-5-amino-2,4-dihydroxypyrimidine
 
** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione
 
** ARP
 
** 6-(1-D-ribitylamino)-5-aminouracil
 
** 5-amino-6-(1-D-ribitylamino)pyrimidine-2,4(1H,3H)-dione
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[LUMAZINESYN-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[Enoylglutaryl-ACP-methyl-esters]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Glutaryl-ACP-methyl-esters]][c]
* [[RIBOFLAVIN-SYN-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 an enoylglutaryl-[acp] methyl ester[c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a glutaryl-[acp] methyl ester[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00009325001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
 +
** '''7''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C04732 C04732]
+
{{#set: ec number=EC-1.3.1.9}}
* CHEBI:
+
{{#set: gene associated=CHC_T00009325001_1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15934 15934]
+
{{#set: in pathway=PWY-6519}}
* BIGG : 4r5au
+
{{#set: reconstruction category=orthology}}
* PUBCHEM:
+
{{#set: reconstruction tool=pantograph}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=193516 193516]
+
{{#set: reconstruction source=galdieria.sulphuraria}}
* HMDB : HMDB11106
+
{{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)CO}}
+
{{#set: inchi key=InChIKey=XKQZIXVJVUPORE-RPDRRWSUSA-N}}
+
{{#set: common name=5-amino-6-(D-ribitylamino)uracil}}
+
{{#set: molecular weight=276.249    }}
+
{{#set: common name=6-(1-D-ribitylamino)-5-amino-2,4-dihydroxypyrimidine|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione|ARP|6-(1-D-ribitylamino)-5-aminouracil|5-amino-6-(1-D-ribitylamino)pyrimidine-2,4(1H,3H)-dione}}
+
{{#set: consumed by=LUMAZINESYN-RXN}}
+
{{#set: produced by=RIBOFLAVIN-SYN-RXN}}
+

Revision as of 12:02, 18 January 2018

Reaction RXN-11478

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
    • 7 reactions found over 11 reactions in the full pathway

Reconstruction information

External links