Difference between revisions of "PWY0-862"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008379001 == * left end position: ** 61551 * transcription direction: ** NEGATIVE * right end position: ** 62468 * centisome position: ** 55.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K |
| − | * | + | * common name: |
| − | ** | + | ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 447.424 |
* Synonym(s): | * Synonym(s): | ||
| + | ** di-trans,poly-cis-geranylgeranyl diphosphate | ||
| + | ** ω,E,E,Z-geranylgeranyl diphosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN0-5180]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356] |
| + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}} | ||
| + | {{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}} | ||
| + | {{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}} | ||
| + | {{#set: molecular weight=447.424 }} | ||
| + | {{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}} | ||
| + | {{#set: consumed or produced by=RXN0-5180}} | ||
Revision as of 11:02, 18 January 2018
Contents
Metabolite CPD0-1028
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
- inchi key:
- InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
- common name:
- 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
- molecular weight:
- 447.424
- Synonym(s):
- di-trans,poly-cis-geranylgeranyl diphosphate
- ω,E,E,Z-geranylgeranyl diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.
