Difference between revisions of "CHC T00008666001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] == * smiles: ** C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34)))) * inchi key...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16016 RXN-16016] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16016 RXN-16016] ==
−
* smiles:
+
* direction:
−
** C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=IVOMOUWHDPKRLL-KQYNXXCUSA-M
+
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
−
* common name:
+
−
** cyclic-AMP
+
−
* molecular weight:
+
−
** 328.201   
+
 
* Synonym(s):
 
* Synonym(s):
−
** cyclic 3',5'-AMP
 
−
** 3',5'-cyclic AMP
 
−
** adenosine cyclic-3',5'-monophosphate
 
−
** adenosine cyclic-monophosphate
 
−
** adenosine-cyclic-phosphoric-acid
 
−
** cAMP
 
−
** adenosine-cyclic-phosphate
 
−
** adenosine-3',5'-monophosphate
 
−
** adenosine 3',5'-cyclic phosphate
 
−
** adenosine-3',5'-cyclic monophosphate
 
−
** cyclic-3',5'-adenosine monophosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[ADENYLATECYC-RXN]]
+
** 14 [[NADPH]][c] '''+''' 9 [[MALONYL-COA]][c] '''+''' 1 [[ACETYL-COA]][c] '''+''' 22 [[PROTON]][c] '''=>''' 10 [[CO-A]][c] '''+''' 1 [[ARACHIDONIC_ACID]][c] '''+''' 14 [[NADP]][c] '''+''' 8 [[WATER]][c] '''+''' 9 [[CARBON-DIOXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 14 NADPH[c] '''+''' 9 malonyl-CoA[c] '''+''' 1 acetyl-CoA[c] '''+''' 22 H+[c] '''=>''' 10 coenzyme A[c] '''+''' 1 arachidonate[c] '''+''' 14 NADP+[c] '''+''' 8 H2O[c] '''+''' 9 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7583]], arachidonate biosynthesis II (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7583 PWY-7583]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[gap-filling]]:
 +
** [[meneco]]:
 +
*** [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* CAS : 60-92-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC58165
+
{{#set: ec number=EC-2.3.1}}
−
* PUBCHEM:
+
{{#set: in pathway=PWY-7583}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059571 7059571]
+
{{#set: reconstruction category=gap-filling}}
−
* HMDB : HMDB00058
+
{{#set: reconstruction tool=meneco}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=added for gapfilling}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00575 C00575]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5415746.html 5415746]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58165 58165]
+
−
* BIGG : camp
+
−
{{#set: smiles=C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34))))}}
+
−
{{#set: inchi key=InChIKey=IVOMOUWHDPKRLL-KQYNXXCUSA-M}}
+
−
{{#set: common name=cyclic-AMP}}
+
−
{{#set: molecular weight=328.201    }}
+
−
{{#set: common name=cyclic 3',5'-AMP|3',5'-cyclic AMP|adenosine cyclic-3',5'-monophosphate|adenosine cyclic-monophosphate|adenosine-cyclic-phosphoric-acid|cAMP|adenosine-cyclic-phosphate|adenosine-3',5'-monophosphate|adenosine 3',5'-cyclic phosphate|adenosine-3',5'-cyclic monophosphate|cyclic-3',5'-adenosine monophosphate}}
+
−
{{#set: produced by=ADENYLATECYC-RXN}}
+

Revision as of 12:09, 18 January 2018

Reaction RXN-16016

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7583, arachidonate biosynthesis II (bacteria): PWY-7583
    • 1 reactions found over 1 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008666001_1&oldid=6692"