Difference between revisions of "CYP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYCYTIDINE DEOXYCYTIDINE] == * smiles: ** C1(=CN(C(=O)N=C(N)1)C2(CC(O)C(CO)O2)) * inchi key:...") |
(Created page with "Category:Gene == Gene CYP == * Synonym(s): == Reactions associated == * Reaction: C-22_sterol_desaturase ** Source: manual-new_reactions_curation * Reaction: ex...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CYP == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[C-22_sterol_desaturase]] |
| − | + | ** Source: [[manual-new_reactions_curation]] | |
| − | * [[ | + | * Reaction: [[extended_RXN-4243]] |
| − | == | + | ** Source: [[manual-pathmodel_inference_new_rxn]] |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=C-22_sterol_desaturase|extended_RXN-4243}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 16:01, 23 May 2018
Gene CYP
- Synonym(s):
Reactions associated
- Reaction: C-22_sterol_desaturase
- Source: manual-new_reactions_curation
- Reaction: extended_RXN-4243
