Difference between revisions of "CHC T00001257001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Gene == Gene CHC_T00001257001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN3O-203 ** Source: orthology-galdieria.sulphuraria == Pathways...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] ==
+
== Gene CHC_T00001257001_1 ==
* smiles:
+
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J
+
* common name:
+
** 4-trans-undecenoyl-CoA
+
* molecular weight:
+
** 929.765   
+
 
* Synonym(s):
 
* Synonym(s):
** 4E-undecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14789]]
+
* Reaction: [[RXN3O-203]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
* [[RXN-14788]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[PWY-6075]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN3O-203}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658640 90658640]
+
{{#set: pathway associated=PWY-6075}}
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J}}
+
{{#set: common name=4-trans-undecenoyl-CoA}}
+
{{#set: molecular weight=929.765    }}
+
{{#set: common name=4E-undecenoyl-CoA}}
+
{{#set: consumed by=RXN-14789}}
+
{{#set: produced by=RXN-14788}}
+

Revision as of 17:05, 23 May 2018

Gene CHC_T00001257001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links