Difference between revisions of "MET"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] == * smiles: ** CCCCCC(O)[CH]=CC=O * inchi key: ** InChIKey=JVJFIQYAHPMBBX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MET MET] == * smiles: ** CSCCC([N+])C([O-])=O * inchi key: ** InChIKey=FFEARJCKVFRZRR-BYPYZUCNS...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MET MET] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CSCCC([N+])C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=FFEARJCKVFRZRR-BYPYZUCNSA-N |
* common name: | * common name: | ||
| − | ** | + | ** L-methionine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 149.207 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** M |
| + | ** met | ||
| + | ** methionine | ||
| + | ** L-met | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN0-6948]] |
| + | * [[S-ADENMETSYN-RXN]] | ||
| + | * [[RXN-16165]] | ||
| + | * [[biomass_rxn]] | ||
| + | * [[METHIONINE--TRNA-LIGASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14950]] | ||
| + | * [[RXN-8340]] | ||
| + | * [[RXN-17878]] | ||
| + | * [[RXN-14957]] | ||
| + | * [[RXN-14959]] | ||
| + | * [[RXN-17877]] | ||
| + | * [[RXN-17473]] | ||
| + | * [[RXN-17472]] | ||
| + | * [[RXN-17875]] | ||
| + | * [[RXN-17874]] | ||
| + | * [[RXN-17873]] | ||
| + | * [[3.4.11.18-RXN]] | ||
| + | * [[RXN-14480]] | ||
| + | * [[HOMOCYSMETB12-RXN]] | ||
| + | * [[RXN0-949]] | ||
| + | * [[RXN0-1342]] | ||
| + | * [[RXN0-5063]] | ||
| + | * [[2.8.1.6-RXN]] | ||
| + | * [[RXN-17876]] | ||
| + | * [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[HOMOCYSMET-RXN]] | ||
| + | * [[2.1.1.3-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 63-68-3 | ||
| + | * METABOLIGHTS : MTBLC57844 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992087 6992087] |
| − | * | + | * HMDB : HMDB00696 |
| − | ** [http://www. | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00073 C00073] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57844 57844] |
| − | * | + | * BIGG : met__L |
| − | + | {{#set: smiles=CSCCC([N+])C([O-])=O}} | |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=FFEARJCKVFRZRR-BYPYZUCNSA-N}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=L-methionine}} |
| − | {{#set: common name= | + | {{#set: molecular weight=149.207 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=M|met|methionine|L-met}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN0-6948|S-ADENMETSYN-RXN|RXN-16165|biomass_rxn|METHIONINE--TRNA-LIGASE-RXN}} |
| − | {{#set: consumed by=RXN- | + | {{#set: produced by=RXN-14950|RXN-8340|RXN-17878|RXN-14957|RXN-14959|RXN-17877|RXN-17473|RXN-17472|RXN-17875|RXN-17874|RXN-17873|3.4.11.18-RXN|RXN-14480|HOMOCYSMETB12-RXN|RXN0-949|RXN0-1342|RXN0-5063|2.8.1.6-RXN|RXN-17876|HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.}} |
| + | {{#set: reversible reaction associated=HOMOCYSMET-RXN|2.1.1.3-RXN}} | ||
Revision as of 17:11, 23 May 2018
Contents
Metabolite MET
- smiles:
- CSCCC([N+])C([O-])=O
- inchi key:
- InChIKey=FFEARJCKVFRZRR-BYPYZUCNSA-N
- common name:
- L-methionine
- molecular weight:
- 149.207
- Synonym(s):
- M
- met
- methionine
- L-met
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- RXN-14950
- RXN-8340
- RXN-17878
- RXN-14957
- RXN-14959
- RXN-17877
- RXN-17473
- RXN-17472
- RXN-17875
- RXN-17874
- RXN-17873
- 3.4.11.18-RXN
- RXN-14480
- HOMOCYSMETB12-RXN
- RXN0-949
- RXN0-1342
- RXN0-5063
- 2.8.1.6-RXN
- RXN-17876
- HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.
Reaction(s) of unknown directionality
External links
- CAS : 63-68-3
- METABOLIGHTS : MTBLC57844
- PUBCHEM:
- HMDB : HMDB00696
- LIGAND-CPD:
- CHEBI:
- BIGG : met__L
"CSCCC([N+])C([O-])=O" cannot be used as a page name in this wiki.
