Difference between revisions of "4-METHYL-824-CHOLESTADIENOL"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-472 RXN66-472] == * direction: ** LEFT-TO-RIGHT * common name: ** fatty aldehyde dehydrogenas...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-824-CHOLESTADIENOL 4-METHYL-824-CHOLESTADIENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-824-CHOLESTADIENOL 4-METHYL-824-CHOLESTADIENOL] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) |
+ | * inchi key: | ||
+ | ** InChIKey=FOUJWBXBKVVHCJ-YIJYGBTNSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 4α-methyl-zymosterol |
− | * | + | * molecular weight: |
− | + | ** 398.671 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 4α-methyl-5α-cholesta-8,24-dien-3β-ol | ||
+ | ** 4-methyl-8,24-cholestadienol | ||
+ | ** 4-α-methyl-5α-cholesta-8,24-dien-3β-ol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-13709]] | |
− | + | * [[RXN66-315]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05103 C05103] | |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1949 1949] | |
− | + | * METABOLIGHTS : MTBLC1949 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22212495 22212495] |
− | {{#set: | + | * HMDB : HMDB01217 |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=FOUJWBXBKVVHCJ-YIJYGBTNSA-N}} |
− | {{#set: | + | {{#set: common name=4α-methyl-zymosterol}} |
− | + | {{#set: molecular weight=398.671 }} | |
+ | {{#set: common name=4α-methyl-5α-cholesta-8,24-dien-3β-ol|4-methyl-8,24-cholestadienol|4-α-methyl-5α-cholesta-8,24-dien-3β-ol}} | ||
+ | {{#set: consumed by=RXN-13709|RXN66-315}} |
Revision as of 15:31, 23 May 2018
Contents
Metabolite 4-METHYL-824-CHOLESTADIENOL
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=FOUJWBXBKVVHCJ-YIJYGBTNSA-N
- common name:
- 4α-methyl-zymosterol
- molecular weight:
- 398.671
- Synonym(s):
- 4α-methyl-5α-cholesta-8,24-dien-3β-ol
- 4-methyl-8,24-cholestadienol
- 4-α-methyl-5α-cholesta-8,24-dien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.