Difference between revisions of "Stearoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMIDE_RIBOSE NICOTINAMIDE_RIBOSE] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Stearoyl-ACPs Stearoyl-ACPs] == * common name: ** a stearoyl-[acp] * Synonym(s): ** octadecanyl...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMIDE_RIBOSE NICOTINAMIDE_RIBOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Stearoyl-ACPs Stearoyl-ACPs] ==
* smiles:
+
** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)N)C=2))
+
* inchi key:
+
** InChIKey=JLEBZPBDRKPWTD-TURQNECASA-O
+
 
* common name:
 
* common name:
** 1-(β-D ribofuranosyl)nicotinamide
+
** a stearoyl-[acp]
* molecular weight:
+
** 255.25   
+
 
* Synonym(s):
 
* Synonym(s):
** β-nicotinamide D-ribonucleotide
+
** octadecanyl-[acp]
** N-ribosyl-nicotinamide
+
** a stearoyl-[acyl-carrier-protein]
** nicotinamide ribonucleoside
+
** an octadecanoyl-[acp]
** nicotinamide ribose
+
** 18:0-ACP
** nicotinamide riboside
+
** ribosylnicotinamide
+
** nicotinamide-β-riboside
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16076]]
 +
* [[RXN-16024]]
 +
* [[RXN-11707]]
 +
* [[RXN1G-368]]
 +
* [[RXN-9548]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5841]]
+
* [[RXN-9635]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[1.10.99.2-RXN-CPD-7229/PLASTOQUINONE-9/PROTON//CPD-12829/NICOTINAMIDE_RIBOSE.63.]]
 
 
== External links  ==
 
== External links  ==
* CAS : 1341-23-7
+
{{#set: common name=a stearoyl-[acp]}}
* PUBCHEM:
+
{{#set: common name=octadecanyl-[acp]|a stearoyl-[acyl-carrier-protein]|an octadecanoyl-[acp]|18:0-ACP}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439924 439924]
+
{{#set: consumed by=RXN-16076|RXN-16024|RXN-11707|RXN1G-368|RXN-9548}}
* HMDB : HMDB00855
+
{{#set: produced by=RXN-9635}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03150 C03150]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.915.html 915]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15927 15927]
+
* METABOLIGHTS : MTBLC15927
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)N)C=2))}}
+
{{#set: inchi key=InChIKey=JLEBZPBDRKPWTD-TURQNECASA-O}}
+
{{#set: common name=1-(β-D ribofuranosyl)nicotinamide}}
+
{{#set: molecular weight=255.25    }}
+
{{#set: common name=β-nicotinamide D-ribonucleotide|N-ribosyl-nicotinamide|nicotinamide ribonucleoside|nicotinamide ribose|nicotinamide riboside|ribosylnicotinamide|nicotinamide-β-riboside}}
+
{{#set: produced by=RXN-5841}}
+
{{#set: consumed or produced by=1.10.99.2-RXN-CPD-7229/PLASTOQUINONE-9/PROTON//CPD-12829/NICOTINAMIDE_RIBOSE.63.}}
+

Revision as of 17:58, 23 May 2018

Metabolite Stearoyl-ACPs

  • common name:
    • a stearoyl-[acp]
  • Synonym(s):
    • octadecanyl-[acp]
    • a stearoyl-[acyl-carrier-protein]
    • an octadecanoyl-[acp]
    • 18:0-ACP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a stearoyl-[acp" cannot be used as a page name in this wiki.
  • "octadecanyl-[acp" cannot be used as a page name in this wiki.
  • "a stearoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.
  • "an octadecanoyl-[acp" cannot be used as a page name in this wiki.