Difference between revisions of "CPD-18777"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18777 CPD-18777] == * smiles: ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1) * common name: ** my...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1) | ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 244.224 | ** 244.224 | ||
| + | * inchi key: | ||
| + | ** InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M | ||
| + | * common name: | ||
| + | ** mycosporine glycine | ||
* Synonym(s): | * Synonym(s): | ||
| Line 19: | Line 19: | ||
== External links == | == External links == | ||
{{#set: smiles=COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)}} | {{#set: smiles=COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=244.224 }} | {{#set: molecular weight=244.224 }} | ||
| + | {{#set: inchi key=InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M}} | ||
| + | {{#set: common name=mycosporine glycine}} | ||
{{#set: produced by=RXN-17368}} | {{#set: produced by=RXN-17368}} | ||
{{#set: reversible reaction associated=extended_RXN-17371|RXN-17371}} | {{#set: reversible reaction associated=extended_RXN-17371|RXN-17371}} | ||
Latest revision as of 16:21, 9 January 2019
Contents
Metabolite CPD-18777
- smiles:
- COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)
- molecular weight:
- 244.224
- inchi key:
- InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M
- common name:
- mycosporine glycine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)" cannot be used as a page name in this wiki.
