|
|
| Line 1: |
Line 1: |
| − | [[Category:Metabolite]] | + | [[Category:Gene]] |
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P3 DIHYDRONEOPTERIN-P3] == | + | == Gene CHC_T00000892001_1 == |
| − | * smiles:
| + | |
| − | ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])=2))
| + | |
| − | * inchi key:
| + | |
| − | ** InChIKey=DGGUVLXVLHAAGT-XINAWCOVSA-J
| + | |
| − | * common name:
| + | |
| − | ** 7,8-dihydroneopterin 3'-triphosphate
| + | |
| − | * molecular weight:
| + | |
| − | ** 491.141
| + | |
| | * Synonym(s): | | * Synonym(s): |
| − | ** 6-(L-erythro-1,2-dihydroxypropyl 3-triphosphate)-7,8-dihydropterin
| |
| − | ** 6-[(1S,2R)-1,2-dihydroxy-3-triphosphooxypropyl]-7,8-dihydropterin
| |
| − | ** 6-(D-erythro-1',2',3'-trihydroxypropyl)-7,8-dihydropterin-3'-triphosphate
| |
| − | ** 7,8-dihydroneopterin 3'-triphosphate
| |
| − | ** 2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine triphosphate
| |
| − | ** dihydroneopterin triphosphate
| |
| − | ** H2NTP
| |
| − | ** 7,8-dihydroneopterin triphosphate
| |
| | | | |
| − | == Reaction(s) known to consume the compound == | + | == Reactions associated == |
| − | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] | + | * [[GLYRIBONUCSYN-RXN]] |
| − | * [[RXN0-5507]] | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
| − | == Reaction(s) known to produce the compound == | + | ** [[pantograph]]-[[a.taliana]] |
| − | * [[GTP-CYCLOHYDRO-I-RXN]] | + | == Pathways associated == |
| − | == Reaction(s) of unknown directionality ==
| + | * [[PWY-6121]] |
| | + | * [[PWY-6122]] |
| | + | * [[PWY-6277]] |
| | == External links == | | == External links == |
| − | * BIGG : ahdt
| + | {{#set: reaction associated=GLYRIBONUCSYN-RXN}} |
| − | * PUBCHEM:
| + | {{#set: pathway associated=PWY-6121|PWY-6122|PWY-6277}} |
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201779 25201779]
| + | |
| − | * HMDB : HMDB00980
| + | |
| − | * LIGAND-CPD:
| + | |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?C04895 C04895]
| + | |
| − | * CHEBI:
| + | |
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58462 58462]
| + | |
| − | * METABOLIGHTS : MTBLC58462
| + | |
| − | {{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])=2))}} | + | |
| − | {{#set: inchi key=InChIKey=DGGUVLXVLHAAGT-XINAWCOVSA-J}} | + | |
| − | {{#set: common name=7,8-dihydroneopterin 3'-triphosphate}}
| + | |
| − | {{#set: molecular weight=491.141 }}
| + | |
| − | {{#set: common name=6-(L-erythro-1,2-dihydroxypropyl 3-triphosphate)-7,8-dihydropterin|6-[(1S,2R)-1,2-dihydroxy-3-triphosphooxypropyl]-7,8-dihydropterin|6-(D-erythro-1',2',3'-trihydroxypropyl)-7,8-dihydropterin-3'-triphosphate|7,8-dihydroneopterin 3'-triphosphate|2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine triphosphate|dihydroneopterin triphosphate|H2NTP|7,8-dihydroneopterin triphosphate}}
| + | |
| − | {{#set: consumed by=H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN|RXN0-5507}}
| + | |
| − | {{#set: produced by=GTP-CYCLOHYDRO-I-RXN}}
| + | |
