Difference between revisions of "CHC T00000892001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] == * smiles: ** CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-D19-37-MOH-38-Me-C57-1-ACPs cis-D19-37-MOH-38-Me-C57-1-ACPs] == * common name: ** a cis-del...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-D19-37-MOH-38-Me-C57-1-ACPs cis-D19-37-MOH-38-Me-C57-1-ACPs] ==
* smiles:
+
** CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)3)))
+
* inchi key:
+
** InChIKey=ANKZYBDXHMZBDK-SCRDCRAPSA-K
+
 
* common name:
 
* common name:
** FMN
+
** a cis-delta19-37-methoxy-38-methyl-C57:1-[acp]
* molecular weight:
+
** 453.324   
+
 
* Synonym(s):
 
* Synonym(s):
** flavin mononucleotide
 
** riboflavin 5'-phosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FADSYN-RXN]]
+
* [[RXN1G-2544]]
* [[RXN0-5187]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RIBOFLAVINKIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-9510]]
 
 
== External links  ==
 
== External links  ==
* CAS : 146-17-8
+
{{#set: common name=a cis-delta19-37-methoxy-38-methyl-C57:1-[acp]}}
* Wikipedia : Flavin_mononucleotide
+
{{#set: consumed by=RXN1G-2544}}
* METABOLIGHTS : MTBLC58210
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229199 44229199]
+
* HMDB : HMDB01520
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00061 C00061]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58210 58210]
+
* BIGG : fmn
+
{{#set: smiles=CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)3)))}}
+
{{#set: inchi key=InChIKey=ANKZYBDXHMZBDK-SCRDCRAPSA-K}}
+
{{#set: common name=FMN}}
+
{{#set: molecular weight=453.324    }}
+
{{#set: common name=flavin mononucleotide|riboflavin 5'-phosphate}}
+
{{#set: consumed by=FADSYN-RXN|RXN0-5187}}
+
{{#set: produced by=RIBOFLAVINKIN-RXN}}
+
{{#set: consumed or produced by=RXN-9510}}
+

Revision as of 10:52, 18 January 2018

Metabolite cis-D19-37-MOH-38-Me-C57-1-ACPs

  • common name:
    • a cis-delta19-37-methoxy-38-methyl-C57:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta19-37-methoxy-38-methyl-C57:1-[acp" cannot be used as a page name in this wiki.