Difference between revisions of "CHC T00000021001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...") |
(Created page with "Category:Gene == Gene CHC_T00007484001_1 == * Synonym(s): == Reactions associated == * RXN-8665 ** pantograph-galdieria.sulphuraria == Pathways associated ==...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00007484001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-8665]] | |
− | == | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-7765]] | ||
+ | * [[PWY-5651]] | ||
+ | * [[TRPCAT-PWY]] | ||
+ | * [[PWY-6309]] | ||
+ | * [[PWY-7717]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-8665}} | |
− | + | {{#set: pathway associated=PWY-7765|PWY-5651|TRPCAT-PWY|PWY-6309|PWY-7717}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 10:52, 18 January 2018
Gene CHC_T00007484001_1
- Synonym(s):