Difference between revisions of "PWY-6609"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi key: **...") |
(Created page with "Category:Gene == Gene CHC_T00002059001_1 == * Synonym(s): == Reactions associated == * DTMPKI-RXN ** pantograph-galdieria.sulphuraria == Pathways associated =...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00002059001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | == | + | * [[DTMPKI-RXN]] |
− | * [[ | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-7210]] | |
+ | * [[PWY-7198]] | ||
+ | * [[PWY-7184]] | ||
+ | * [[PWY-7187]] | ||
+ | * [[PWY-7197]] | ||
+ | * [[PWY0-166]] | ||
+ | * [[PWY-6545]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=DTMPKI-RXN}} | |
− | + | {{#set: pathway associated=PWY-7210|PWY-7198|PWY-7184|PWY-7187|PWY-7197|PWY0-166|PWY-6545}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 12:15, 18 January 2018
Gene CHC_T00002059001_1
- Synonym(s):