Difference between revisions of "HECT-Ubiquitin-carrier-protein-E3-L-cys"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5856 PWY-5856] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5856 PWY-5856] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** ( | + | ** ubiquinol-9 biosynthesis (prokaryotic) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Q9 biosynthesis |
+ | ** ubiquinone-9 biosynthesis (prokaryotic) | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''2''' reaction(s) found |
− | == Reaction(s) | + | ** [[2.1.1.64-RXN]] |
− | * [[ | + | ** [[2.5.1.39-RXN]] |
− | == | + | == Reaction(s) not found == |
+ | * '''6''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9239 RXN-9239] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9238 RXN-9238] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9240 RXN-9240] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9241 RXN-9241] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9242 RXN-9242] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9243 RXN-9243] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=ubiquinol-9 biosynthesis (prokaryotic)}} | |
− | + | {{#set: common name=Q9 biosynthesis|ubiquinone-9 biosynthesis (prokaryotic)}} | |
− | + | {{#set: reaction found=2}} | |
− | {{#set: | + | {{#set: reaction not found=6}} |
− | + | ||
− | {{#set: common name=( | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:25, 18 January 2018
Pathway PWY-5856
- taxonomic range:
- common name:
- ubiquinol-9 biosynthesis (prokaryotic)
- Synonym(s):
- Q9 biosynthesis
- ubiquinone-9 biosynthesis (prokaryotic)
Reaction(s) found
- 2 reaction(s) found