Difference between revisions of "INDOXYL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * common name: ** indoxyl * molecul...") |
(No difference)
|
Latest revision as of 17:36, 21 June 2019
Contents
Metabolite INDOXYL
- smiles:
- C2(C=CC1(=C(C(O)=CN1)C=2))
- common name:
- indoxyl
- molecular weight:
- 133.149
- inchi key:
- InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
- Synonym(s):
- indole-3-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links