Difference between revisions of "SULFATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFATE SULFATE] == * smiles: ** O=S(=O)([O-])[O-] * inchi key: ** InChIKey=QAOWNCQODCNURD-UHFF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == |
* smiles: | * smiles: | ||
− | ** | + | ** C=C1(C(CC([N+])C([O-])=O)C1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** hypoglycin A |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 141.169 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** hypoglycine |
− | ** | + | ** hypoglycine A |
− | ** | + | ** hypoglycin |
− | ** | + | ** L-β-(methylenecyclopropyl)-alanine |
− | + | ** 2-amino-3-(2-methylidenecyclopropyl)propanoic acid | |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9157]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244430 25244430] |
− | * | + | * Wikipedia : Hypoglycin |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08287 C08287] |
− | * | + | * HMDB : HMDB29427 |
− | + | {{#set: smiles=C=C1(C(CC([N+])C([O-])=O)C1)}} | |
− | + | {{#set: inchi key=InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N}} | |
− | + | {{#set: common name=hypoglycin A}} | |
− | + | {{#set: molecular weight=141.169 }} | |
− | {{#set: smiles= | + | {{#set: common name=hypoglycine|hypoglycine A|hypoglycin|L-β-(methylenecyclopropyl)-alanine|2-amino-3-(2-methylidenecyclopropyl)propanoic acid}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN-9157}} |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: consumed | + |
Revision as of 22:27, 17 March 2018
Contents
Metabolite CPD-9699
- smiles:
- C=C1(C(CC([N+])C([O-])=O)C1)
- inchi key:
- InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N
- common name:
- hypoglycin A
- molecular weight:
- 141.169
- Synonym(s):
- hypoglycine
- hypoglycine A
- hypoglycin
- L-β-(methylenecyclopropyl)-alanine
- 2-amino-3-(2-methylidenecyclopropyl)propanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C(CC([N+])C([O-])=O)C1)" cannot be used as a page name in this wiki.