Difference between revisions of "RXN-17792"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == * smiles: ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15681 RXN-15681] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-benzyl-3,6 -bis(glutathio...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15681 RXN-15681] ==
* smiles:
+
* direction:
** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N
+
 
* common name:
 
* common name:
** XXXG xyloglucan oligosaccharide
+
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine γ-glutamyltransferase
* molecular weight:
+
** Gamma-glutamylcyclotransferase
** 1062.931   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.2 EC-2.3.2]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12400]]
+
** 1 [[CPD-17046]][c] '''=>''' 2 [[5-OXOPROLINE]][c] '''+''' 1 [[CPD-17047]][c]
* [[RXN-12399]]
+
* With common name(s):
* [[RXN-12398]]
+
** 1 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine[c] '''=>''' 2 5-oxo-L-proline[c] '''+''' 1 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine[c]
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-06_002460]]
 +
** ESILICULOSUS_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7533]], gliotoxin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7533 PWY-7533]
 +
** '''3''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940180 52940180]
+
{{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine γ-glutamyltransferase}}
{{#set: smiles=C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)}}
+
{{#set: common name=Gamma-glutamylcyclotransferase}}
{{#set: inchi key=InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N}}
+
{{#set: ec number=EC-2.3.2}}
{{#set: common name=XXXG xyloglucan oligosaccharide}}
+
{{#set: gene associated=Ec-06_002460}}
{{#set: molecular weight=1062.931    }}
+
{{#set: in pathway=PWY-7533}}
{{#set: produced by=RXN-12400|RXN-12399|RXN-12398}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 21:44, 17 March 2018

Reaction RXN-15681

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine γ-glutamyltransferase
    • Gamma-glutamylcyclotransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine[c] => 2 5-oxo-L-proline[c] + 1 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7533, gliotoxin biosynthesis: PWY-7533
    • 3 reactions found over 9 reactions in the full pathway

Reconstruction information

External links