Difference between revisions of "RXN-16592"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] == * smiles: ** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Ec-28_000680 == * left end position: ** 636085 * transcription direction: ** POSITIVE * right end position: ** 641957 * centisome position: ** 16.787...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-28_000680 == |
− | * | + | * left end position: |
− | ** | + | ** 636085 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 641957 |
− | * | + | * centisome position: |
− | ** | + | ** 16.787586 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0098_0022 |
− | ** | + | ** Esi0098_0022 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[2.7.13.3-RXN]] | |
− | + | ** esiliculosus_genome | |
− | * [[ | + | ***ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=636085}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=641957}} | |
− | + | {{#set: centisome position=16.787586 }} | |
− | + | {{#set: common name=Esi_0098_0022|Esi0098_0022}} | |
− | + | {{#set: reaction associated=2.7.13.3-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:56, 17 March 2018
Gene Ec-28_000680
- left end position:
- 636085
- transcription direction:
- POSITIVE
- right end position:
- 641957
- centisome position:
- 16.787586
- Synonym(s):
- Esi_0098_0022
- Esi0098_0022
Reactions associated
- 2.7.13.3-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome