Difference between revisions of "Ec-26 004100"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * smiles: ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Ec-05_005460 == * left end position: ** 7384989 * transcription direction: ** NEGATIVE * right end position: ** 7389367 * centisome position: ** 81.1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-05_005460 == |
− | * | + | * left end position: |
− | ** | + | ** 7384989 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 7389367 |
− | * | + | * centisome position: |
− | ** | + | ** 81.12249 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0152_0006 |
− | ** | + | ** Esi0152_0006 |
− | ** | + | ** GPX |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[GLUTATHIONE-PEROXIDASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***ec-number |
+ | == Pathways associated == | ||
+ | * [[DETOX1-PWY-1]] | ||
+ | * [[PWY-4081]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7384989}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=7389367}} | |
− | + | {{#set: centisome position=81.12249 }} | |
− | + | {{#set: common name=Esi_0152_0006|Esi0152_0006|GPX}} | |
− | + | {{#set: reaction associated=GLUTATHIONE-PEROXIDASE-RXN}} | |
− | + | {{#set: pathway associated=DETOX1-PWY-1|PWY-4081}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:04, 17 March 2018
Gene Ec-05_005460
- left end position:
- 7384989
- transcription direction:
- NEGATIVE
- right end position:
- 7389367
- centisome position:
- 81.12249
- Synonym(s):
- Esi_0152_0006
- Esi0152_0006
- GPX
Reactions associated
- GLUTATHIONE-PEROXIDASE-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome