Difference between revisions of "2.4.1.150-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17397 CPD-17397] == * common name: ** a [glycerolipid]-densipolate * Synonym(s): ** a [glyc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == |
+ | * smiles: | ||
+ | ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** dIDP |
+ | * molecular weight: | ||
+ | ** 409.165 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** deoxyinosine diphosphate |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-14228]] |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344] |
− | {{#set: reversible reaction associated=RXN- | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286] | ||
+ | * BIGG : 37395 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552] | ||
+ | * HMDB : HMDB03536 | ||
+ | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | ||
+ | {{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}} | ||
+ | {{#set: common name=dIDP}} | ||
+ | {{#set: molecular weight=409.165 }} | ||
+ | {{#set: common name=deoxyinosine diphosphate}} | ||
+ | {{#set: reversible reaction associated=RXN-14228}} |
Revision as of 13:42, 21 March 2018
Contents
Metabolite CPD0-2231
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- inchi key:
- InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
- common name:
- dIDP
- molecular weight:
- 409.165
- Synonym(s):
- deoxyinosine diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.