Difference between revisions of "LUMAZINESYN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRUVATE PYRUVATE] == * smiles: ** CC(=O)C(=O)[O-] * inchi key: ** InChIKey=LCTONWCANYUPML-UHFF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] == * smiles: ** CCCC(OCC(OC(CCC)=O)CO)=O * inchi key: ** InChIKey=AWHAUPZH...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCC(OCC(OC(CCC)=O)CO)=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N |
* common name: | * common name: | ||
− | ** | + | ** 1,2-dibutyrin |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 232.276 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** glycerol 1,2-dibutanoate |
− | + | ** β-dibutyrin | |
− | ** & | + | ** butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester |
− | ** | + | ** dibutyrylglycerol |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12086]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | + | * CAS : 24814-35-5 | |
− | * CAS : | + | |
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327007 5327007] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.8352519.html 8352519] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76537 76537] |
− | + | {{#set: smiles=CCCC(OCC(OC(CCC)=O)CO)=O}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=1,2-dibutyrin}} |
− | {{#set: common name= | + | {{#set: molecular weight=232.276 }} |
− | {{#set: molecular weight= | + | {{#set: common name=glycerol 1,2-dibutanoate|β-dibutyrin|butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester|dibutyrylglycerol}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-12086}} |
− | + | ||
− | {{#set: produced by= | + | |
− | + |
Revision as of 14:43, 21 March 2018
Contents
Metabolite CPD-13040
- smiles:
- CCCC(OCC(OC(CCC)=O)CO)=O
- inchi key:
- InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N
- common name:
- 1,2-dibutyrin
- molecular weight:
- 232.276
- Synonym(s):
- glycerol 1,2-dibutanoate
- β-dibutyrin
- butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester
- dibutyrylglycerol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links