Difference between revisions of "PWY-5022"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5022 PWY-5022] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5022 PWY-5022] ==
−
* smiles:
+
* taxonomic range:
−
** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
−
* inchi key:
+
−
** InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
+
 
* common name:
 
* common name:
−
** 5-amino-6-(5-phospho-D-ribitylamino)uracil
+
** 4-aminobutanoate degradation V
−
* molecular weight:
+
−
** 354.213   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-amino-6-(5'-phosphoribitylamino)uracil
+
** GABA degradation
−
** 5-amino-6-(5-phosphoribitylamino)uracil
+
−
** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''7''' reactions in the full pathway
−
* [[RIBOFLAVINSYNREDUC-RXN]]
+
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-12_008040]]
 +
*** [[Ec-06_008240]]
 +
*** [[Ec-06_001980]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXYBUTYRATE-DEHYDROGENASE-RXN 4-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA-DEHYDROGENASE-RXN BUTYRYL-COA-DEHYDROGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GABATRANSAM-RXN GABATRANSAM-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R11-RXN R11-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8889 RXN-8889]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8890 RXN-8890]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-1239}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04454 C04454]
+
{{#set: common name=4-aminobutanoate degradation V}}
−
* CHEBI:
+
{{#set: common name=GABA degradation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58421 58421]
+
{{#set: reaction found=1}}
−
* BIGG : 43851
+
{{#set: total reaction=7}}
−
* PUBCHEM:
+
{{#set: completion rate=14.0}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266638 45266638]
+
−
* HMDB : HMDB03841
+
−
{{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L}}
+
−
{{#set: common name=5-amino-6-(5-phospho-D-ribitylamino)uracil}}
+
−
{{#set: molecular weight=354.213    }}
+
−
{{#set: common name=5-amino-6-(5'-phosphoribitylamino)uracil|5-amino-6-(5-phosphoribitylamino)uracil|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate}}
+
−
{{#set: produced by=RIBOFLAVINSYNREDUC-RXN}}
+

Latest revision as of 19:03, 21 March 2018

Pathway PWY-5022

  • taxonomic range:
  • common name:
    • 4-aminobutanoate degradation V
  • Synonym(s):
    • GABA degradation

Reaction(s) found

1 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5022&oldid=24152"