Difference between revisions of "SUCUTIL-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SUCUTIL-PWY SUCUTIL-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SUCUTIL-PWY SUCUTIL-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
* common name: | * common name: | ||
− | ** | + | ** sucrose degradation I (sucrose phosphotransferase) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
− | * [[ | + | * [[FRUCTOKINASE-RXN]] |
− | * [[ | + | ** 1 associated gene(s): |
− | == Reaction(s) | + | *** [[Ec-18_002990]] |
− | * [ | + | ** 1 reconstruction source(s) associated: |
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.26-RXN 3.2.1.26-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=SUCROSEPHOSPHO-RXN SUCROSEPHOSPHO-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: common name=sucrose degradation I (sucrose phosphotransferase)}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:04, 21 March 2018
Pathway SUCUTIL-PWY
- taxonomic range:
- common name:
- sucrose degradation I (sucrose phosphotransferase)
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- FRUCTOKINASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: