Difference between revisions of "PWY-5321"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * smiles: ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] * inchi key: ** InChIKey=PMOW...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5321 PWY-5321] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3700 TAX-37...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5321 PWY-5321] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3700 TAX-3700] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** quercetin glycoside biosynthesis (Arabidopsis) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''12''' reactions in the full pathway |
− | == Reaction(s) | + | * [[RXN1F-462]] |
− | * [[RXN- | + | ** 2 associated gene(s): |
− | == | + | *** [[Ec-14_000870]] |
+ | *** [[Ec-04_004610]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13797 RXN-13797] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14000 RXN-14000] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14011 RXN-14011] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14012 RXN-14012] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8264 RXN-8264] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8265 RXN-8265] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8267 RXN-8267] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8268 RXN-8268] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8271 RXN-8271] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4161 RXNQT-4161] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4162 RXNQT-4162] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5321 PWY-5321] |
− | + | {{#set: taxonomic range=TAX-3700}} | |
− | + | {{#set: common name=quercetin glycoside biosynthesis (Arabidopsis)}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=12}} | |
− | + | {{#set: completion rate=8.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:06, 21 March 2018
Pathway PWY-5321
- taxonomic range:
- common name:
- quercetin glycoside biosynthesis (Arabidopsis)
- Synonym(s):
Reaction(s) found
1 reactions found over 12 reactions in the full pathway
- RXN1F-462
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- RXN-13797
- RXN-14000
- RXN-14011
- RXN-14012
- RXN-8264
- RXN-8265
- RXN-8267
- RXN-8268
- RXN-8271
- RXNQT-4161
- RXNQT-4162
External links
- ARACYC: