Difference between revisions of "PWY-7724"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7724 PWY-7724] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7724 PWY-7724] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
+
 
* common name:
 
* common name:
−
** 24-methylenecholesterol
+
** icosapentaenoate biosynthesis III (8-desaturase, mammals)
−
* molecular weight:
+
−
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** eicosapentaenoic acid biosynthesis III
 +
** eicosapentaenoate biosynthesis III (metazoa)
 +
** iicosapentaenoic acid biosynthesis III
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''7''' reactions in the full pathway
−
* [[RXN-707]]
+
* [[LINOLENOYL-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Ec-02_006430]]
 +
*** [[Ec-12_008720]]
 +
*** [[Ec-01_001560]]
 +
*** [[Ec-03_003710]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12994 RXN-12994]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12997 RXN-12997]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13001 RXN-13001]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13429 RXN-13429]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13441 RXN-13441]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17106 RXN-17106]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33208}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724573 23724573]
+
{{#set: taxonomic range=TAX-4751}}
−
* LIGAND-CPD:
+
{{#set: common name=icosapentaenoate biosynthesis III (8-desaturase, mammals)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
+
{{#set: common name=eicosapentaenoic acid biosynthesis III|eicosapentaenoate biosynthesis III (metazoa)|iicosapentaenoic acid biosynthesis III}}
−
* HMDB : HMDB06849
+
{{#set: reaction found=1}}
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: total reaction=7}}
−
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
+
{{#set: completion rate=14.0}}
−
{{#set: common name=24-methylenecholesterol}}
+
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: produced by=RXN-707}}
+

Latest revision as of 19:17, 21 March 2018

Pathway PWY-7724

  • taxonomic range:
  • common name:
    • icosapentaenoate biosynthesis III (8-desaturase, mammals)
  • Synonym(s):
    • eicosapentaenoic acid biosynthesis III
    • eicosapentaenoate biosynthesis III (metazoa)
    • iicosapentaenoic acid biosynthesis III

Reaction(s) found

1 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7724&oldid=25849"