Difference between revisions of "ALPHA-GLUCOSE-16-BISPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYPHENYLGLYCOLALDEHYDE DIHYDROXYPHENYLGLYCOLALDEHYDE] == * smiles: ** C(=O)C(O)C1(C=CC(O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-]...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-]) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J |
* common name: | * common name: | ||
− | ** | + | ** α-glucose 1,6-bisphosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 336.085 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** α-D-glucose 1,6-P2 |
− | ** | + | ** α-D-glucopyranose 1,6-bisphosphate |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-16997]] | ||
+ | * [[RXN-16998]] | ||
== External links == | == External links == | ||
+ | * CAS : 10139-18-1 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201676 25201676] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58392 58392] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C( | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01231 C01231] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB03514 |
− | {{#set: common name= | + | {{#set: smiles=C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-])}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J}} |
− | {{#set: common name= | + | {{#set: common name=α-glucose 1,6-bisphosphate}} |
− | {{#set: | + | {{#set: molecular weight=336.085 }} |
+ | {{#set: common name=α-D-glucose 1,6-P2|α-D-glucopyranose 1,6-bisphosphate}} | ||
+ | {{#set: reversible reaction associated=RXN-16997|RXN-16998}} |
Latest revision as of 19:20, 21 March 2018
Contents
Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE
- smiles:
- C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-])
- inchi key:
- InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J
- common name:
- α-glucose 1,6-bisphosphate
- molecular weight:
- 336.085
- Synonym(s):
- α-D-glucose 1,6-P2
- α-D-glucopyranose 1,6-bisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-])" cannot be used as a page name in this wiki.