Difference between revisions of "CPD-332"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-23_002490 == * left end position: ** 2592008 * transcription direction: ** POSITIVE * right end position: ** 2599405 * centisome position: ** 53.5...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * smiles: ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) * inchi key: ** InChIKey=XXFA...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-23_002490 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] ==
−
* left end position:
+
* smiles:
−
** 2592008
+
** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N
−
* right end position:
+
* common name:
−
** 2599405
+
** dihydrozeatin
−
* centisome position:
+
* molecular weight:
−
** 53.55978    
+
** 221.261    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0132_0050
+
** 2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol
−
** Esi0132_0050
+
** N6-(4-Hydroxyisopentanyl)adenine
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[LYSOPHOSPHOLIPASE-RXN]]
+
* [[RXN-4726]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-15035]]
+
−
** esiliculosus_genome
+
−
***automated-name-match
+
−
== Pathways associated ==
+
−
* [[PWY-7409]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2592008}}
+
* CAS : 23599-75-9
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=2599405}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439631 439631]
−
{{#set: centisome position=53.55978   }}
+
* HMDB : HMDB12215
−
{{#set: common name=Esi_0132_0050|Esi0132_0050}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02029 C02029]
−
{{#set: pathway associated=PWY-7409}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.388705.html 388705]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17874 17874]
 +
{{#set: smiles=CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2))}}
 +
{{#set: inchi key=InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N}}
 +
{{#set: common name=dihydrozeatin}}
 +
{{#set: molecular weight=221.261   }}
 +
{{#set: common name=2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol|N6-(4-Hydroxyisopentanyl)adenine}}
 +
{{#set: consumed by=RXN-4726}}

Latest revision as of 19:21, 21 March 2018

Metabolite CPD-332

  • smiles:
    • CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2))
  • inchi key:
    • InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N
  • common name:
    • dihydrozeatin
  • molecular weight:
    • 221.261
  • Synonym(s):
    • 2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol
    • N6-(4-Hydroxyisopentanyl)adenine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-332&oldid=26387"