Difference between revisions of "CPD-13907"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] == * smiles: ** C(OP([O-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N |
* common name: | * common name: | ||
| − | ** | + | ** dehydroascorbate (bicyclic form) |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 192.125 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dehydroascorbate monohydrate |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12861]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12862]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659000 90659000] |
| − | + | {{#set: smiles=C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))}} | |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=dehydroascorbate (bicyclic form)}} |
| − | {{#set: common name= | + | {{#set: molecular weight=192.125 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=dehydroascorbate monohydrate}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-12861}} |
| − | {{#set: consumed by=RXN- | + | {{#set: produced by=RXN-12862}} |
| − | {{#set: produced by=RXN- | + | |
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite CPD-13907
- smiles:
- C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))
- inchi key:
- InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N
- common name:
- dehydroascorbate (bicyclic form)
- molecular weight:
- 192.125
- Synonym(s):
- dehydroascorbate monohydrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))" cannot be used as a page name in this wiki.
