Difference between revisions of "CPD0-1133"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476 RXN66-476] == * direction: ** LEFT-TO-RIGHT * common name: ** fatty aldehyde dehydrogenas...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476 RXN66-476] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))
 +
* inchi key:
 +
** InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N
 
* common name:
 
* common name:
−
** fatty aldehyde dehydrogenase
+
** maltoheptaose
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
+
** 1153.009   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14283]]
−
** 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Odd-Straight-Chain-234-Sat-FALD]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[Odd-Straight-Chain-234-Sat-FA]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD+[c] '''+''' 1 H2O[c] '''+''' 1 an odd numbered straight chain 2,3,4-saturated fatty aldehyde[c] '''=>''' 2 H+[c] '''+''' 1 NADH[c] '''+''' 1 an odd numbered straight chain 2,3,4-saturated fatty acid[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY66-388]], fatty acid α-oxidation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-388 PWY66-388]
+
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=fatty aldehyde dehydrogenase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?G00689 G00689]
−
{{#set: ec number=EC-1.2.1.3}}
+
* CHEBI:
−
{{#set: in pathway=PWY66-388}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61954 61954]
−
{{#set: reconstruction category=annotation}}
+
* METABOLIGHTS : MTBLC61954
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
* PUBCHEM:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13908996 13908996]
 +
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))}}
 +
{{#set: inchi key=InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N}}
 +
{{#set: common name=maltoheptaose}}
 +
{{#set: molecular weight=1153.009    }}
 +
{{#set: consumed by=RXN-14283}}

Latest revision as of 19:32, 21 March 2018

Metabolite CPD0-1133

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))
  • inchi key:
    • InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N
  • common name:
    • maltoheptaose
  • molecular weight:
    • 1153.009
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-1133&oldid=27665"