Difference between revisions of "XANTHURENATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.13.8-RXN 1.14.13.8-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** N,N-dimethylaniline...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHURENATE XANTHURENATE] == * smiles: ** C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-])) * inch...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHURENATE XANTHURENATE] == |
− | * | + | * smiles: |
− | ** | + | ** C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-])) |
+ | * inchi key: | ||
+ | ** InChIKey=FBZONXHGGPHHIY-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** xanthurenate |
− | * | + | * molecular weight: |
− | ** | + | ** 203.154 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10722]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02470 C02470] | |
− | * LIGAND- | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71201 71201] |
− | * | + | * METABOLIGHTS : MTBLC71201 |
− | ** [http://www. | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203183 25203183] | |
− | + | * HMDB : HMDB00881 | |
− | * | + | {{#set: smiles=C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-]))}} |
− | * | + | {{#set: inchi key=InChIKey=FBZONXHGGPHHIY-UHFFFAOYSA-L}} |
− | ** [http:// | + | {{#set: common name=xanthurenate}} |
− | + | {{#set: molecular weight=203.154 }} | |
− | + | {{#set: produced by=RXN-10722}} | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite XANTHURENATE
- smiles:
- C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-]))
- inchi key:
- InChIKey=FBZONXHGGPHHIY-UHFFFAOYSA-L
- common name:
- xanthurenate
- molecular weight:
- 203.154
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-]))" cannot be used as a page name in this wiki.