Difference between revisions of "CPD-19153"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-146 RXN66-146] == * direction: ** LEFT-TO-RIGHT * common name: ** Aromatic-ring hydroxylase-l...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-146 RXN66-146] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
 
* common name:
 
* common name:
** Aromatic-ring hydroxylase-like
+
** 3-oxo-(5Z)-dodecenoyl-CoA
** Monooxygenase, FAD-binding
+
* molecular weight:
* ec number:
+
** 957.775   
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-12:1-Δ5-CoA
 +
** 3-oxo-5-cis-dodecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[NICOTINE]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-3187]][c] '''+''' 1 [[WATER]][c]
+
* [[RXN-17798]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 oxygen[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 (S)-nicotine[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 2'-hydroxynicotine[c] '''+''' 1 H2O[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-01_010880]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
* [[Ec-00_001320]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
* [[Ec-26_003280]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
== Pathways  ==
+
* [[PWY66-201]], nicotine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-201 PWY66-201]
+
** '''2''' reactions found over '''17''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: common name=Aromatic-ring hydroxylase-like}}
+
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}}
{{#set: common name=Monooxygenase, FAD-binding}}
+
{{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}}
{{#set: ec number=EC-1.14.14.1}}
+
{{#set: molecular weight=957.775    }}
{{#set: gene associated=Ec-01_010880|Ec-00_001320|Ec-26_003280}}
+
{{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}}
{{#set: in pathway=PWY66-201}}
+
{{#set: produced by=RXN-17798}}
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:38, 21 March 2018

Metabolite CPD-19153

  • smiles:
    • CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
  • common name:
    • 3-oxo-(5Z)-dodecenoyl-CoA
  • molecular weight:
    • 957.775
  • Synonym(s):
    • 3-oxo-12:1-Δ5-CoA
    • 3-oxo-5-cis-dodecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.