Difference between revisions of "Ec-01 006960"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * smiles: ** C(=O)([O-])C1(C=CC(=CC=1)N) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-01_006960 == * left end position: ** 5959922 * transcription direction: ** POSITIVE * right end position: ** 5972407 * centisome position: ** 57.7...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_006960 == |
− | * | + | * left end position: |
− | ** | + | ** 5959922 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5972407 |
− | * | + | * centisome position: |
− | ** | + | ** 57.757706 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0002_0235 |
− | ** | + | ** Esi0002_0235 |
− | ** | + | ** CTSH |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.4.22.16-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=5959922}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5972407}} | |
− | + | {{#set: centisome position=57.757706 }} | |
− | + | {{#set: common name=Esi_0002_0235|Esi0002_0235|CTSH}} | |
− | + | {{#set: reaction associated=3.4.22.16-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:47, 21 March 2018
Gene Ec-01_006960
- left end position:
- 5959922
- transcription direction:
- POSITIVE
- right end position:
- 5972407
- centisome position:
- 57.757706
- Synonym(s):
- Esi_0002_0235
- Esi0002_0235
- CTSH
Reactions associated
- Reaction: 3.4.22.16-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome