Difference between revisions of "RXN-12486"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == * smiles: ** C(C1(C(=CC=CC=1)N))(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12486 RXN-12486] == * direction: ** REVERSIBLE * common name: ** GDP-L-galactose/GDP-D-glucose...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12486 RXN-12486] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** GDP-L-galactose/GDP-D-glucose phosphorylase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.7.7.78 EC-2.7.7.78] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1 [[GDP-D-GLUCOSE]][c] '''+''' 1 [[Pi]][c] '''<=>''' 1 [[GDP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[GLC-1-P]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 GDP-α-D-glucose[c] '''+''' 1 phosphate[c] '''<=>''' 1 GDP[c] '''+''' 1 H+[c] '''+''' 1 α-D-glucopyranose 1-phosphate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-15_001960]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30390 30390] | |
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | ** [http:// | + | {{#set: common name=GDP-L-galactose/GDP-D-glucose phosphorylase}} |
| − | + | {{#set: ec number=EC-2.7.7.78}} | |
| − | + | {{#set: gene associated=Ec-15_001960}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:48, 21 March 2018
Contents
Reaction RXN-12486
- direction:
- REVERSIBLE
- common name:
- GDP-L-galactose/GDP-D-glucose phosphorylase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 GDP-D-GLUCOSE[c] + 1 Pi[c] <=> 1 GDP[c] + 1 PROTON[c] + 1 GLC-1-P[c]
- With common name(s):
- 1 GDP-α-D-glucose[c] + 1 phosphate[c] <=> 1 GDP[c] + 1 H+[c] + 1 α-D-glucopyranose 1-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-15_001960
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
