Difference between revisions of "CPD-19162"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] == * smiles: ** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] == * smiles: ** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J |
* common name: | * common name: | ||
− | ** ( | + | ** (2E,9Z)-hexadecenoyl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 997.883 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 16:2-Δ2,Δ9-CoA |
+ | ** 2-trans,9-cis-hexadecenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-17789]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-17788]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | + | {{#set: inchi key=InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J}} | |
− | + | {{#set: common name=(2E,9Z)-hexadecenoyl-CoA}} | |
− | + | {{#set: molecular weight=997.883 }} | |
− | {{#set: smiles= | + | {{#set: common name=16:2-Δ2,Δ9-CoA|2-trans,9-cis-hexadecenoyl-CoA}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN-17789}} |
− | {{#set: common name=( | + | {{#set: produced by=RXN-17788}} |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: produced by=RXN- | + |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-19162
- smiles:
- CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J
- common name:
- (2E,9Z)-hexadecenoyl-CoA
- molecular weight:
- 997.883
- Synonym(s):
- 16:2-Δ2,Δ9-CoA
- 2-trans,9-cis-hexadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.