Difference between revisions of "Ec-26 004100"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * smiles: ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O * inchi key: ** InChIKey=...")
 
(Created page with "Category:Gene == Gene Ec-26_004100 == * left end position: ** 4349863 * transcription direction: ** POSITIVE * right end position: ** 4358370 * centisome position: ** 66.0...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] ==
+
== Gene Ec-26_004100 ==
−
* smiles:
+
* left end position:
−
** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O
+
** 4349863
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** tributyrin
+
** 4358370
−
* molecular weight:
+
* centisome position:
−
** 302.367    
+
** 66.07372    
 
* Synonym(s):
 
* Synonym(s):
−
** butyryl triglyceride
+
** Esi_0320_0040
−
** butanoic acid, 1,2,3-propanetriyl ester
+
** Esi0320_0040
−
** 1,2,3-tributyrylglycerol
+
−
** tributin
+
−
** tributyrinine
+
−
** glycerol tributyrate
+
−
** glyceryl tributyrate
+
−
** butyrin
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12086]]
+
* Reaction: [[PRPPSYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY0-662]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=4349863}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C13870 C13870]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=4358370}}
−
** [http://www.chemspider.com/Chemical-Structure.13849665.html 13849665]
+
{{#set: centisome position=66.07372   }}
−
* CHEBI:
+
{{#set: common name=Esi_0320_0040|Esi0320_0040}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35020 35020]
+
{{#set: reaction associated=PRPPSYN-RXN}}
−
* PUBCHEM:
+
{{#set: pathway associated=PWY0-662}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6050 6050]
+
−
* HMDB : HMDB31094
+
−
{{#set: smiles=CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O}}
+
−
{{#set: inchi key=InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N}}
+
−
{{#set: common name=tributyrin}}
+
−
{{#set: molecular weight=302.367   }}
+
−
{{#set: common name=butyryl triglyceride|butanoic acid, 1,2,3-propanetriyl ester|1,2,3-tributyrylglycerol|tributin|tributyrinine|glycerol tributyrate|glyceryl tributyrate|butyrin}}
+
−
{{#set: consumed by=RXN-12086}}
+

Latest revision as of 19:59, 21 March 2018

Gene Ec-26_004100

  • left end position:
    • 4349863
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4358370
  • centisome position:
    • 66.07372
  • Synonym(s):
    • Esi_0320_0040
    • Esi0320_0040

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_004100&oldid=30729"