Difference between revisions of "CPD0-2121"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_002160 == * left end position: ** 2192577 * transcription direction: ** NEGATIVE * right end position: ** 2201110 * centisome position: ** 42.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2121 CPD0-2121] == * smiles: ** CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2121 CPD0-2121] == |
− | * | + | * smiles: |
− | ** | + | ** CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OINXHIBNZUUIMR-IXUYQXAASA-J |
− | * | + | * common name: |
− | ** | + | ** trans-hex-2-enoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 859.631 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** hexenoyl-CoA |
− | ** | + | ** (2E)-hexenoyl-CoA |
+ | ** trans-2-hexenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12567]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : 45472 |
− | {{#set: | + | * LIPID_MAPS : LMFA07050019 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921640 52921640] |
− | {{#set: common name= | + | * HMDB : HMDB03944 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05271 C05271] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62077 62077] | ||
+ | * METABOLIGHTS : MTBLC28706 | ||
+ | {{#set: smiles=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=OINXHIBNZUUIMR-IXUYQXAASA-J}} | ||
+ | {{#set: common name=trans-hex-2-enoyl-CoA}} | ||
+ | {{#set: molecular weight=859.631 }} | ||
+ | {{#set: common name=hexenoyl-CoA|(2E)-hexenoyl-CoA|trans-2-hexenoyl-CoA}} | ||
+ | {{#set: produced by=RXN-12567}} |
Latest revision as of 20:59, 21 March 2018
Contents
Metabolite CPD0-2121
- smiles:
- CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=OINXHIBNZUUIMR-IXUYQXAASA-J
- common name:
- trans-hex-2-enoyl-CoA
- molecular weight:
- 859.631
- Synonym(s):
- hexenoyl-CoA
- (2E)-hexenoyl-CoA
- trans-2-hexenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 45472
- LIPID_MAPS : LMFA07050019
- PUBCHEM:
- HMDB : HMDB03944
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC28706
"CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.