Difference between revisions of "PWY-5022"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-02_002820 == * left end position: ** 3081342 * transcription direction: ** NEGATIVE * right end position: ** 3089605 * centisome position: ** 47.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L |
| − | * | + | * common name: |
| − | ** | + | ** 5-amino-6-(5-phospho-D-ribitylamino)uracil |
| − | * | + | * molecular weight: |
| − | ** | + | ** 354.213 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 5-amino-6-(5'-phosphoribitylamino)uracil |
| − | ** | + | ** 5-amino-6-(5-phosphoribitylamino)uracil |
| + | ** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RIBOFLAVINSYNREDUC-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04454 C04454] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58421 58421] |
| − | {{#set: common name= | + | * BIGG : 43851 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266638 45266638] | ||
| + | * HMDB : HMDB03841 | ||
| + | {{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L}} | ||
| + | {{#set: common name=5-amino-6-(5-phospho-D-ribitylamino)uracil}} | ||
| + | {{#set: molecular weight=354.213 }} | ||
| + | {{#set: common name=5-amino-6-(5'-phosphoribitylamino)uracil|5-amino-6-(5-phosphoribitylamino)uracil|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate}} | ||
| + | {{#set: produced by=RIBOFLAVINSYNREDUC-RXN}} | ||
Revision as of 20:29, 17 March 2018
Contents
Metabolite CPD-1086
- smiles:
- C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
- inchi key:
- InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
- common name:
- 5-amino-6-(5-phospho-D-ribitylamino)uracil
- molecular weight:
- 354.213
- Synonym(s):
- 5-amino-6-(5'-phosphoribitylamino)uracil
- 5-amino-6-(5-phosphoribitylamino)uracil
- 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.
