Difference between revisions of "CYS-GLY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...")
 
(Created page with "Category:Gene == Gene Ec-04_003190 == * left end position: ** 3251186 * transcription direction: ** NEGATIVE * right end position: ** 3257815 * centisome position: ** 49.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] ==
+
== Gene Ec-04_003190 ==
−
* smiles:
+
* left end position:
−
** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
+
** 3251186
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5-amino-6-(5-phospho-D-ribitylamino)uracil
+
** 3257815
−
* molecular weight:
+
* centisome position:
−
** 354.213    
+
** 49.927216    
 
* Synonym(s):
 
* Synonym(s):
−
** 5-amino-6-(5'-phosphoribitylamino)uracil
+
** Esi_0080_0114
−
** 5-amino-6-(5-phosphoribitylamino)uracil
+
** Esi0080_0114
−
** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate
+
** PK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
−
* [[RIBOFLAVINSYNREDUC-RXN]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=3251186}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04454 C04454]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=3257815}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58421 58421]
+
{{#set: centisome position=49.927216   }}
−
* BIGG : 43851
+
{{#set: common name=Esi_0080_0114|Esi0080_0114|PK}}
−
* PUBCHEM:
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266638 45266638]
+
−
* HMDB : HMDB03841
+
−
{{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L}}
+
−
{{#set: common name=5-amino-6-(5-phospho-D-ribitylamino)uracil}}
+
−
{{#set: molecular weight=354.213   }}
+
−
{{#set: common name=5-amino-6-(5'-phosphoribitylamino)uracil|5-amino-6-(5-phosphoribitylamino)uracil|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate}}
+
−
{{#set: produced by=RIBOFLAVINSYNREDUC-RXN}}
+

Revision as of 20:29, 17 March 2018

Gene Ec-04_003190

  • left end position:
    • 3251186
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3257815
  • centisome position:
    • 49.927216
  • Synonym(s):
    • Esi_0080_0114
    • Esi0080_0114
    • PK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CYS-GLY&oldid=9125"