Difference between revisions of "Ec-11 004120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Ec-11_004120 == * left end position: ** 4199298 * transcription direction: ** NEGATIVE * right end position: ** 4208297 * centisome position: ** 66.7...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] ==
+
== Gene Ec-11_004120 ==
−
* smiles:
+
* left end position:
−
** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)
+
** 4199298
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** hydroxybupropion
+
** 4208297
−
* molecular weight:
+
* centisome position:
−
** 256.752    
+
** 66.76512    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0192_0023
 +
** Esi0192_0023
 +
** HSDH
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[HOMOSERDEHYDROG-RXN]]
−
* [[RXN66-181]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[HOMOSERSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4199298}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202442 25202442]
+
{{#set: transcription direction=NEGATIVE}}
−
* HMDB : HMDB12235
+
{{#set: right end position=4208297}}
−
{{#set: smiles=CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)}}
+
{{#set: centisome position=66.76512    }}
−
{{#set: inchi key=InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O}}
+
{{#set: common name=Esi_0192_0023|Esi0192_0023|HSDH}}
−
{{#set: common name=hydroxybupropion}}
+
{{#set: reaction associated=HOMOSERDEHYDROG-RXN}}
−
{{#set: molecular weight=256.752    }}
+
{{#set: pathway associated=HOMOSERSYN-PWY}}
−
{{#set: produced by=RXN66-181}}
+

Latest revision as of 19:12, 21 March 2018

Gene Ec-11_004120

  • left end position:
    • 4199298
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4208297
  • centisome position:
    • 66.76512
  • Synonym(s):
    • Esi_0192_0023
    • Esi0192_0023
    • HSDH

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-11_004120&oldid=25275"