Difference between revisions of "CYSTINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aliphatic-Amines Aliphatic-Amines] == * common name: ** an aliphatic amine * Synonym(s): ** RCH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * inchi key: ** InChIKe...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == |
+ | * smiles: | ||
+ | ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] | ||
+ | * inchi key: | ||
+ | ** InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-cystine |
+ | * molecular weight: | ||
+ | ** 240.292 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[CYSTHIOCYS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-15128]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 24645-67-8 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992103 6992103] |
+ | * HMDB : HMDB00192 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01420 C01420] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35491 35491] | ||
+ | * METABOLIGHTS : MTBLC35491 | ||
+ | {{#set: smiles=C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+]}} | ||
+ | {{#set: inchi key=InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N}} | ||
+ | {{#set: common name=L-cystine}} | ||
+ | {{#set: molecular weight=240.292 }} | ||
+ | {{#set: consumed by=CYSTHIOCYS-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-15128}} |
Latest revision as of 19:12, 21 March 2018
Contents
Metabolite CYSTINE
- smiles:
- C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+]
- inchi key:
- InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N
- common name:
- L-cystine
- molecular weight:
- 240.292
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 24645-67-8
- PUBCHEM:
- HMDB : HMDB00192
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC35491
"C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+" cannot be used as a page name in this wiki.