Difference between revisions of "CPD0-1028"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5781 RXN-5781] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.7.8...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5781 RXN-5781] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.8.2 EC-2.7.8.2]
+
** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
 +
* common name:
 +
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
 +
* molecular weight:
 +
** 447.424   
 
* Synonym(s):
 
* Synonym(s):
 +
** di-trans,poly-cis-geranylgeranyl diphosphate
 +
** ω,E,E,Z-geranylgeranyl diphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[DIACYLGLYCEROL]][c] '''+''' 1 [[CDP-CHOLINE]][c] '''<=>''' 1 [[PHOSPHATIDYLCHOLINE]][c] '''+''' 1 [[CMP]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-13323]]
−
** 1 a 1,2-diacyl-sn-glycerol[c] '''+''' 1 CDP-choline[c] '''<=>''' 1 a phosphatidylcholine[c] '''+''' 1 CMP[c] '''+''' 1 H+[c]
+
* [[RXN0-5180]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY4FS-2]], phosphatidylcholine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-2 PWY4FS-2]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-3561]], choline biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3561 PWY-3561]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6804]], diacylglycerol biosynthesis (PUFA enrichment in oilseed): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6804 PWY-6804]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-7367]], phosphatidylcholine resynthesis via glycerophosphocholine: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7367 PWY-7367]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY3O-450]], phosphatidylcholine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-450 PWY3O-450]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01321 R01321]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826]
−
* UNIPROT:
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P17898 P17898]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639]
−
{{#set: direction=REVERSIBLE}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.7.8.2}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356]
−
{{#set: in pathway=PWY4FS-2|PWY-3561|PWY-6804|PWY-7367|PWY3O-450}}
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=447.424    }}
 +
{{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|&omega;,E,E,Z-geranylgeranyl diphosphate}}
 +
{{#set: reversible reaction associated=RXN-13323|RXN0-5180}}

Latest revision as of 19:14, 21 March 2018

Metabolite CPD0-1028

  • smiles:
    • CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
  • inchi key:
    • InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
  • common name:
    • 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
  • molecular weight:
    • 447.424
  • Synonym(s):
    • di-trans,poly-cis-geranylgeranyl diphosphate
    • ω,E,E,Z-geranylgeranyl diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-1028&oldid=25543"