Difference between revisions of "Ec-06 002470"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == * smiles: ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
 
(Created page with "Category:Gene == Gene Ec-06_002470 == * left end position: ** 1801804 * transcription direction: ** NEGATIVE * right end position: ** 1808086 * centisome position: ** 20.5...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] ==
+
== Gene Ec-06_002470 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** 1801804
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (S)-3-hydroxydecanoyl-CoA
+
** 1808086
−
* molecular weight:
+
* centisome position:
−
** 933.753    
+
** 20.573803    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0384_0022
 +
** Esi0384_0022
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12490]]
+
* Reaction: [[URATE-OXIDASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-13616]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-5691]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=1801804}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05264 C05264]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1808086}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62616 62616]
+
{{#set: centisome position=20.573803    }}
−
* BIGG : 45455
+
{{#set: common name=Esi_0384_0022|Esi0384_0022}}
−
* PUBCHEM:
+
{{#set: reaction associated=URATE-OXIDASE-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859629 49859629]
+
{{#set: pathway associated=PWY-5691}}
−
* HMDB : HMDB03938
+
−
{{#set: smiles=CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
−
{{#set: inchi key=InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J}}
+
−
{{#set: common name=(S)-3-hydroxydecanoyl-CoA}}
+
−
{{#set: molecular weight=933.753    }}
+
−
{{#set: consumed by=RXN-12490}}
+
−
{{#set: produced by=RXN-13616}}
+

Latest revision as of 19:00, 21 March 2018

Gene Ec-06_002470

  • left end position:
    • 1801804
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1808086
  • centisome position:
    • 20.573803
  • Synonym(s):
    • Esi_0384_0022
    • Esi0384_0022

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_002470&oldid=23737"