Difference between revisions of "PWY-7187"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7187 PWY-7187] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7187 PWY-7187] ==
−
* smiles:
+
* taxonomic range:
−
** [CH](=O)C(O)COP(=O)([O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=LXJXRIRHZLFYRP-VKHMYHEASA-L
+
 
* common name:
 
* common name:
−
** D-glyceraldehyde 3-phosphate
+
** pyrimidine deoxyribonucleotides de novo biosynthesis II
−
* molecular weight:
+
−
** 168.043   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-phosphoglyceraldehyde
 
−
** D-glyceraldehyde-3-P
 
−
** glyceraldehyde 3-phosphate
 
−
** GAP
 
−
** glyceraldehyde-phosphate
 
−
** glyceraldehyde-P
 
−
** glyceraldehyde-3-P
 
−
** (2R)-2-hydroxy-3-(phosphonooxy)-propanal
 
−
** triose phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[DXS-RXN]]
+
'''6''' reactions found over '''7''' reactions in the full pathway
−
* [[RXN0-7250]]
+
* [[DTDPKIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 7 associated gene(s):
−
* [[KDPGALDOL-RXN]]
+
*** [[Ec-26_003930]]
−
* [[TRYPSYN-RXN]]
+
*** [[Ec-07_000140]]
−
* [[1.2.1.13-RXN]]
+
*** [[Ec-03_001380]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-22_003280]]
−
* [[1TRANSKETO-RXN]]
+
*** [[Ec-04_001140]]
−
* [[TRANSALDOL-RXN]]
+
*** [[Ec-11_004330]]
−
* [[RXN0-2381]]
+
*** [[Ec-11_005170]]
−
* [[TRIOSEPISOMERIZATION-RXN]]
+
** 2 reconstruction source(s) associated:
−
* [[2TRANSKETO-RXN]]
+
*** [[annotation-esiliculosus_genome]]
−
* [[GAPOXNPHOSPHN-RXN]]
+
*** [[orthology-aragem]]
−
* [[F16ALDOLASE-RXN]]
+
* [[DTMPKI-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-20_004950]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[DUTP-PYROP-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-13_002810]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN0-723]]
 +
** 1 associated gene(s):
 +
*** [[Ec-04_006460]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-724]]
 +
** 1 associated gene(s):
 +
*** [[Ec-04_006460]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[THYMIDYLATESYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_004630]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DCTP-DEAM-RXN DCTP-DEAM-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 591-57-1
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7187 PWY-7187]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24794350 24794350]
+
{{#set: taxonomic range=TAX-2157}}
−
* HMDB : HMDB01112
+
{{#set: taxonomic range=TAX-2}}
−
* LIGAND-CPD:
+
{{#set: common name=pyrimidine deoxyribonucleotides de novo biosynthesis II}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00118 C00118]
+
{{#set: reaction found=6}}
−
* CHEBI:
+
{{#set: total reaction=7}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59776 59776]
+
{{#set: completion rate=86.0}}
−
* BIGG : 35637
+
−
{{#set: smiles=[CH](=O)C(O)COP(=O)([O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LXJXRIRHZLFYRP-VKHMYHEASA-L}}
+
−
{{#set: common name=D-glyceraldehyde 3-phosphate}}
+
−
{{#set: molecular weight=168.043    }}
+
−
{{#set: common name=3-phosphoglyceraldehyde|D-glyceraldehyde-3-P|glyceraldehyde 3-phosphate|GAP|glyceraldehyde-phosphate|glyceraldehyde-P|glyceraldehyde-3-P|(2R)-2-hydroxy-3-(phosphonooxy)-propanal|triose phosphate}}
+
−
{{#set: consumed by=DXS-RXN|RXN0-7250}}
+
−
{{#set: produced by=KDPGALDOL-RXN|TRYPSYN-RXN|1.2.1.13-RXN}}
+
−
{{#set: reversible reaction associated=1TRANSKETO-RXN|TRANSALDOL-RXN|RXN0-2381|TRIOSEPISOMERIZATION-RXN|2TRANSKETO-RXN|GAPOXNPHOSPHN-RXN|F16ALDOLASE-RXN}}
+

Latest revision as of 19:23, 21 March 2018

Pathway PWY-7187

  • taxonomic range:
  • common name:
    • pyrimidine deoxyribonucleotides de novo biosynthesis II
  • Synonym(s):

Reaction(s) found

6 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7187&oldid=26590"