|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SULFATE-ADENYLYLTRANS-RXN SULFATE-ADENYLYLTRANS-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C |
| + | * inchi key: |
| + | ** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N |
| * common name: | | * common name: |
− | ** Sulphate adenylyltransferase catalytic domain | + | ** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/2.7.7.4 EC-2.7.7.4] | + | ** 412.698 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN66-14]] |
− | ** 1 [[PROTON]][c] '''+''' 1 [[SULFATE]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[APS]][c] '''+''' 1 [[PPI]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[RXN66-13]] |
− | ** 1 H+[c] '''+''' 1 sulfate[c] '''+''' 1 ATP[c] '''<=>''' 1 adenosine 5'-phosphosulfate[c] '''+''' 1 diphosphate[c]
| + | * [[RXN-13707]] |
− | | + | == Reaction(s) of unknown directionality == |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-12_000240]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-02_000870]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | == Pathways == | + | |
− | * [[DISSULFRED-PWY]], sulfate reduction IV (dissimilatory): [http://metacyc.org/META/NEW-IMAGE?object=DISSULFRED-PWY DISSULFRED-PWY]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-5340]], sulfate activation for sulfonation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5340 PWY-5340]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY-5278]], sulfite oxidation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5278 PWY-5278] | + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[SULFMETII-PWY]], sulfate reduction II (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=SULFMETII-PWY SULFMETII-PWY] | + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-6683]], sulfate reduction III (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6683 PWY-6683]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[P224-PWY]], sulfate reduction V (dissimilatory): [http://metacyc.org/META/NEW-IMAGE?object=P224-PWY P224-PWY]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-aragem]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18133 18133] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200473 25200473] |
− | * LIGAND-RXN:
| + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00529 R00529]
| + | {{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}} |
− | * UNIPROT:
| + | {{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}} |
− | ** [http://www.uniprot.org/uniprot/Q12650 Q12650]
| + | {{#set: molecular weight=412.698 }} |
− | ** [http://www.uniprot.org/uniprot/O33581 O33581]
| + | {{#set: consumed by=RXN66-14}} |
− | ** [http://www.uniprot.org/uniprot/O34764 O34764]
| + | {{#set: produced by=RXN66-13|RXN-13707}} |
− | ** [http://www.uniprot.org/uniprot/Q10600 Q10600]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67174 O67174]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21156 P21156]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23324 O23324]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JUD7 Q9JUD7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PM66 Q9PM66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JUD6 Q9JUD6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28604 P28604]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27128 Q27128]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23845 P23845]
| + | |
− | ** [http://www.uniprot.org/uniprot/O43252 O43252]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43170 Q43170]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43183 Q43183]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43870 Q43870]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12555 Q12555]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08536 P08536]
| + | |
− | ** [http://www.uniprot.org/uniprot/P74241 P74241]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48888 O48888]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39595 Q39595]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96349 Q96349]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96541 Q96541]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S7D8 Q9S7D8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13441 P13441]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13442 P13442]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=Sulphate adenylyltransferase catalytic domain}}
| + | |
− | {{#set: ec number=EC-2.7.7.4}}
| + | |
− | {{#set: gene associated=Ec-12_000240|Ec-02_000870}} | + | |
− | {{#set: in pathway=DISSULFRED-PWY|PWY-5340|PWY-5278|SULFMETII-PWY|PWY-6683|P224-PWY}} | + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}} | + | |